C14H22ClNO2 — CID 104930483
1-[4-[(1R)-1-aminoethyl]-2-chlorophenoxy]-2,3-dimethylbutan-2-ol (PubChem CID 104930483) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 1-[4-[(1R)-1-aminoethyl]-2-chlorophenoxy]-2,3-dimethylbutan-2-ol.
| Compound Name | 1-[4-[(1R)-1-aminoethyl]-2-chlorophenoxy]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 104930483 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-[4-[(1R)-1-aminoethyl]-2-chlorophenoxy]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)COc1ccc([C@@H](C)N)cc1Cl |
| InChI | InChI=1S/C14H22ClNO2/c1-9(2)14(4,17)8-18-13-6-5-11(10(3)16)7-12(13)15/h5-7,9-10,17H,8,16H2,1-4H3/t10-,14?/m1/s1 |
| InChIKey | NLLKERNJIBXXPP-IAPIXIRKSA-N |
| XLogP | 3.15 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |