C16H16ClF2NO — CID 104893345
(1R)-1-[3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]ethanamine (PubChem CID 104893345) has the molecular formula C16H16ClF2NO and a molecular weight of 311.76 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 104893345 |
| Molecular Formula | C16H16ClF2NO |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (1R)-1-[3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCC(F)(F)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClF2NO/c1-11(20)12-7-8-15(14(17)9-12)21-10-16(18,19)13-5-3-2-4-6-13/h2-9,11H,10,20H2,1H3/t11-/m1/s1 |
| InChIKey | QTCYSLPJLFNFBC-LLVKDONJSA-N |
| XLogP | 4.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |