C16H16F3NO — CID 104893336
(1S)-1-[2-(2,2-difluoro-2-phenylethoxy)-4-fluorophenyl]ethanamine (PubChem CID 104893336) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is (1S)-1-[2-(2,2-difluoro-2-phenylethoxy)-4-fluorophenyl]ethanamine.
| Compound Name | (1S)-1-[2-(2,2-difluoro-2-phenylethoxy)-4-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 104893336 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (1S)-1-[2-(2,2-difluoro-2-phenylethoxy)-4-fluorophenyl]ethanamine |
| SMILES | C[C@H](N)c1ccc(F)cc1OCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C16H16F3NO/c1-11(20)14-8-7-13(17)9-15(14)21-10-16(18,19)12-5-3-2-4-6-12/h2-9,11H,10,20H2,1H3/t11-/m0/s1 |
| InChIKey | KUXLNIADWKSYBG-NSHDSACASA-N |
| XLogP | 4.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |