C17H19FO3 — CID 63366269
1-[5-fluoro-2-[(1S)-1-hydroxyethyl]phenoxy]-2-phenylpropan-2-ol (PubChem CID 63366269) has the molecular formula C17H19FO3 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-[5-fluoro-2-[(1S)-1-hydroxyethyl]phenoxy]-2-phenylpropan-2-ol.
| Compound Name | 1-[5-fluoro-2-[(1S)-1-hydroxyethyl]phenoxy]-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 63366269 |
| Molecular Formula | C17H19FO3 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[5-fluoro-2-[(1S)-1-hydroxyethyl]phenoxy]-2-phenylpropan-2-ol |
| SMILES | C[C@H](O)c1ccc(F)cc1OCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C17H19FO3/c1-12(19)15-9-8-14(18)10-16(15)21-11-17(2,20)13-6-4-3-5-7-13/h3-10,12,19-20H,11H2,1-2H3/t12-,17?/m0/s1 |
| InChIKey | IGOOZTALAWLGFQ-WHUIICBVSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |