C15H14ClF2NO — CID 116788441
[3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]methanamine (PubChem CID 116788441) has the molecular formula C15H14ClF2NO and a molecular weight of 297.73 g/mol. Its IUPAC name is [3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]methanamine.
| Compound Name | [3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 116788441 |
| Molecular Formula | C15H14ClF2NO |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | [3-chloro-4-(2,2-difluoro-2-phenylethoxy)phenyl]methanamine |
| SMILES | NCc1ccc(OCC(F)(F)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClF2NO/c16-13-8-11(9-19)6-7-14(13)20-10-15(17,18)12-4-2-1-3-5-12/h1-8H,9-10,19H2 |
| InChIKey | SSGXSIIWUAGFBP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |