C14H12ClF2NO — CID 107716169
3-chloro-2-(2,2-difluoro-2-phenylethoxy)aniline (PubChem CID 107716169) has the molecular formula C14H12ClF2NO and a molecular weight of 283.71 g/mol. Its IUPAC name is 3-chloro-2-(2,2-difluoro-2-phenylethoxy)aniline.
| Compound Name | 3-chloro-2-(2,2-difluoro-2-phenylethoxy)aniline |
|---|---|
| PubChem CID | 107716169 |
| Molecular Formula | C14H12ClF2NO |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-chloro-2-(2,2-difluoro-2-phenylethoxy)aniline |
| SMILES | Nc1cccc(Cl)c1OCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C14H12ClF2NO/c15-11-7-4-8-12(18)13(11)19-9-14(16,17)10-5-2-1-3-6-10/h1-8H,9,18H2 |
| InChIKey | KDEKRZMEMOWDGH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|