C14H11Cl2F2NO — CID 116788470
3,5-dichloro-4-(2,2-difluoro-2-phenylethoxy)aniline (PubChem CID 116788470) has the molecular formula C14H11Cl2F2NO and a molecular weight of 318.15 g/mol. Its IUPAC name is 3,5-dichloro-4-(2,2-difluoro-2-phenylethoxy)aniline.
| Compound Name | 3,5-dichloro-4-(2,2-difluoro-2-phenylethoxy)aniline |
|---|---|
| PubChem CID | 116788470 |
| Molecular Formula | C14H11Cl2F2NO |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 3,5-dichloro-4-(2,2-difluoro-2-phenylethoxy)aniline |
| SMILES | Nc1cc(Cl)c(OCC(F)(F)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2F2NO/c15-11-6-10(19)7-12(16)13(11)20-8-14(17,18)9-4-2-1-3-5-9/h1-7H,8,19H2 |
| InChIKey | UCILNRITYIJCOC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|