C14H21ClO4S — CID 106726351
(1S)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanol (PubChem CID 106726351) has the molecular formula C14H21ClO4S and a molecular weight of 320.84 g/mol. Its IUPAC name is (1S)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanol.
| Compound Name | (1S)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanol |
|---|---|
| PubChem CID | 106726351 |
| Molecular Formula | C14H21ClO4S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (1S)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(OCCS(=O)(=O)C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClO4S/c1-10(16)11-5-6-13(12(15)9-11)19-7-8-20(17,18)14(2,3)4/h5-6,9-10,16H,7-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | MQRMGJGKTXHKLA-JTQLQIEISA-N |
| XLogP | 2.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |