C15H24O5S — CID 106726236
(1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]ethanol (PubChem CID 106726236) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is (1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]ethanol.
| Compound Name | (1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 106726236 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]ethanol |
| SMILES | COc1cc([C@@H](C)O)ccc1OCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H24O5S/c1-11(16)12-6-7-13(14(10-12)19-5)20-8-9-21(17,18)15(2,3)4/h6-7,10-11,16H,8-9H2,1-5H3/t11-/m1/s1 |
| InChIKey | FBRXHJXSBJYJCD-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |