C13H17F3O4 — CID 63364673
(1R)-1-[3-methoxy-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol (PubChem CID 63364673) has the molecular formula C13H17F3O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is (1R)-1-[3-methoxy-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol.
| Compound Name | (1R)-1-[3-methoxy-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 63364673 |
| Molecular Formula | C13H17F3O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (1R)-1-[3-methoxy-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol |
| SMILES | COc1cc([C@@H](C)O)ccc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C13H17F3O4/c1-9(17)10-3-4-11(12(7-10)18-2)20-6-5-19-8-13(14,15)16/h3-4,7,9,17H,5-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | FFKNPLYMPYYMQB-SECBINFHSA-N |
| XLogP | 2.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|