C13H20O4 — CID 63364683
1-[4-[(1R)-1-hydroxyethyl]-2-methoxyphenoxy]-2-methylpropan-2-ol (PubChem CID 63364683) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-[4-[(1R)-1-hydroxyethyl]-2-methoxyphenoxy]-2-methylpropan-2-ol.
| Compound Name | 1-[4-[(1R)-1-hydroxyethyl]-2-methoxyphenoxy]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 63364683 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-[4-[(1R)-1-hydroxyethyl]-2-methoxyphenoxy]-2-methylpropan-2-ol |
| SMILES | COc1cc([C@@H](C)O)ccc1OCC(C)(C)O |
| InChI | InChI=1S/C13H20O4/c1-9(14)10-5-6-11(12(7-10)16-4)17-8-13(2,3)15/h5-7,9,14-15H,8H2,1-4H3/t9-/m1/s1 |
| InChIKey | DWLIMFVFYZBLSE-SECBINFHSA-N |
| XLogP | 1.90 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |