C15H24O4 — CID 103034187
(1S)-1-[3-methoxy-4-(3-methoxy-3-methylbutoxy)phenyl]ethanol (PubChem CID 103034187) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1S)-1-[3-methoxy-4-(3-methoxy-3-methylbutoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[3-methoxy-4-(3-methoxy-3-methylbutoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 103034187 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1S)-1-[3-methoxy-4-(3-methoxy-3-methylbutoxy)phenyl]ethanol |
| SMILES | COc1cc([C@H](C)O)ccc1OCCC(C)(C)OC |
| InChI | InChI=1S/C15H24O4/c1-11(16)12-6-7-13(14(10-12)17-4)19-9-8-15(2,3)18-5/h6-7,10-11,16H,8-9H2,1-5H3/t11-/m0/s1 |
| InChIKey | SACQXXGACUIMJX-NSHDSACASA-N |
| XLogP | 2.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |