C16H26O4 — CID 106666594
1-[4-methoxy-3-[(3-methoxy-3-methylbutoxy)methyl]phenyl]ethanol (PubChem CID 106666594) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[4-methoxy-3-[(3-methoxy-3-methylbutoxy)methyl]phenyl]ethanol.
| Compound Name | 1-[4-methoxy-3-[(3-methoxy-3-methylbutoxy)methyl]phenyl]ethanol |
|---|---|
| PubChem CID | 106666594 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[4-methoxy-3-[(3-methoxy-3-methylbutoxy)methyl]phenyl]ethanol |
| SMILES | COc1ccc(C(C)O)cc1COCCC(C)(C)OC |
| InChI | InChI=1S/C16H26O4/c1-12(17)13-6-7-15(18-4)14(10-13)11-20-9-8-16(2,3)19-5/h6-7,10,12,17H,8-9,11H2,1-5H3 |
| InChIKey | RZAIZHFNYMKXGZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|