C15H25NO4S — CID 106722034
1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]-N-methylmethanamine (PubChem CID 106722034) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]-N-methylmethanamine.
| Compound Name | 1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 106722034 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[4-(2-tert-butylsulfonylethoxy)-3-methoxyphenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(OCCS(=O)(=O)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H25NO4S/c1-15(2,3)21(17,18)9-8-20-13-7-6-12(11-16-4)10-14(13)19-5/h6-7,10,16H,8-9,11H2,1-5H3 |
| InChIKey | VZQJLHSMSZJCBU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |