C13H18Cl2O3S — CID 106726569
1-(2-tert-butylsulfonylethoxy)-2-chloro-4-(chloromethyl)benzene (PubChem CID 106726569) has the molecular formula C13H18Cl2O3S and a molecular weight of 325.26 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethoxy)-2-chloro-4-(chloromethyl)benzene.
| Compound Name | 1-(2-tert-butylsulfonylethoxy)-2-chloro-4-(chloromethyl)benzene |
|---|---|
| PubChem CID | 106726569 |
| Molecular Formula | C13H18Cl2O3S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-(2-tert-butylsulfonylethoxy)-2-chloro-4-(chloromethyl)benzene |
| SMILES | CC(C)(C)S(=O)(=O)CCOc1ccc(CCl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2O3S/c1-13(2,3)19(16,17)7-6-18-12-5-4-10(9-14)8-11(12)15/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | XZKJGKRWTHZRQW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|