C10H12BrClO3S — CID 63051476
2-bromo-4-(chloromethyl)-1-(2-methylsulfonylethoxy)benzene (PubChem CID 63051476) has the molecular formula C10H12BrClO3S and a molecular weight of 327.63 g/mol. Its IUPAC name is 2-bromo-4-(chloromethyl)-1-(2-methylsulfonylethoxy)benzene.
| Compound Name | 2-bromo-4-(chloromethyl)-1-(2-methylsulfonylethoxy)benzene |
|---|---|
| PubChem CID | 63051476 |
| Molecular Formula | C10H12BrClO3S |
| Molecular Weight | 327.63 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | 2-bromo-4-(chloromethyl)-1-(2-methylsulfonylethoxy)benzene |
| SMILES | CS(=O)(=O)CCOc1ccc(CCl)cc1Br |
| InChI | InChI=1S/C10H12BrClO3S/c1-16(13,14)5-4-15-10-3-2-8(7-12)6-9(10)11/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | JNHBMOJUSKANON-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|