C13H21NO5S2 — CID 61057154
4-(2-ethylsulfonylethoxy)-3-propan-2-ylbenzenesulfonamide (PubChem CID 61057154) has the molecular formula C13H21NO5S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(2-ethylsulfonylethoxy)-3-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-(2-ethylsulfonylethoxy)-3-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 61057154 |
| Molecular Formula | C13H21NO5S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-(2-ethylsulfonylethoxy)-3-propan-2-ylbenzenesulfonamide |
| SMILES | CCS(=O)(=O)CCOc1ccc(S(N)(=O)=O)cc1C(C)C |
| InChI | InChI=1S/C13H21NO5S2/c1-4-20(15,16)8-7-19-13-6-5-11(21(14,17)18)9-12(13)10(2)3/h5-6,9-10H,4,7-8H2,1-3H3,(H2,14,17,18) |
| InChIKey | DNHHIEDWTGEWBA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |