C11H16FNO3S — CID 80695433
4-(2-fluoroethoxy)-3-propan-2-ylbenzenesulfonamide (PubChem CID 80695433) has the molecular formula C11H16FNO3S and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-3-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-(2-fluoroethoxy)-3-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 80695433 |
| Molecular Formula | C11H16FNO3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-(2-fluoroethoxy)-3-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1cc(S(N)(=O)=O)ccc1OCCF |
| InChI | InChI=1S/C11H16FNO3S/c1-8(2)10-7-9(17(13,14)15)3-4-11(10)16-6-5-12/h3-4,7-8H,5-6H2,1-2H3,(H2,13,14,15) |
| InChIKey | JHLRGYKWIFFYKN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |