About 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide
4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide (PubChem CID 82911019) has the molecular formula C13H18N2O5S
and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide |
| PubChem CID | 82911019 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1cc(S(N)(=O)=O)ccc1OCC1CNC(=O)O1 |
| InChI | InChI=1S/C13H18N2O5S/c1-8(2)11-5-10(21(14,17)18)3-4-12(11)19-7-9-6-15-13(16)20-9/h3-5,8-9H,6-7H2,1-2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | WNBQNBHCLOFXQJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide?
The IUPAC name of 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide (CID 82911019) is 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide.
What is the SMILES notation for 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide?
The canonical SMILES for 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide is CC(C)c1cc(S(N)(=O)=O)ccc1OCC1CNC(=O)O1.
What is the InChIKey of 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide?
The InChIKey is WNBQNBHCLOFXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5S/c1-8(2)11-5-10(21(14,17)18)3-4-12(11)19-7-9-6-15-13(16)20-9/h3-5,8-9H,6-7H2,1-2H3,(H,15,16)(H2,14,17,18).
What are the key properties of 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide?
4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide has a molecular weight of 314.36 g/mol, XLogP of 0.94, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-3-propan-2-ylbenzenesulfonamide is sourced from PubChem (CID 82911019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).