C12H18ClNO5S — CID 103410565
3-chloro-4-[3-(2-methoxyethoxy)propoxy]benzenesulfonamide (PubChem CID 103410565) has the molecular formula C12H18ClNO5S and a molecular weight of 323.80 g/mol. Its IUPAC name is 3-chloro-4-[3-(2-methoxyethoxy)propoxy]benzenesulfonamide.
| Compound Name | 3-chloro-4-[3-(2-methoxyethoxy)propoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 103410565 |
| Molecular Formula | C12H18ClNO5S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-chloro-4-[3-(2-methoxyethoxy)propoxy]benzenesulfonamide |
| SMILES | COCCOCCCOc1ccc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C12H18ClNO5S/c1-17-7-8-18-5-2-6-19-12-4-3-10(9-11(12)13)20(14,15)16/h3-4,9H,2,5-8H2,1H3,(H2,14,15,16) |
| InChIKey | FTKHQJTYZZUFGS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|