C14H14ClNO3S — CID 61373703
3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonamide (PubChem CID 61373703) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is 3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonamide.
| Compound Name | 3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 61373703 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonamide |
| SMILES | Cc1cc(C)cc(Oc2ccc(S(N)(=O)=O)cc2Cl)c1 |
| InChI | InChI=1S/C14H14ClNO3S/c1-9-5-10(2)7-11(6-9)19-14-4-3-12(8-13(14)15)20(16,17)18/h3-8H,1-2H3,(H2,16,17,18) |
| InChIKey | BWNFORCSUHMHFV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |