C14H12Cl2O3S — CID 61372963
3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonyl chloride (PubChem CID 61372963) has the molecular formula C14H12Cl2O3S and a molecular weight of 331.22 g/mol. Its IUPAC name is 3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonyl chloride.
| Compound Name | 3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 61372963 |
| Molecular Formula | C14H12Cl2O3S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3-chloro-4-(3,5-dimethylphenoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(C)cc(Oc2ccc(S(=O)(=O)Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H12Cl2O3S/c1-9-5-10(2)7-11(6-9)19-14-4-3-12(8-13(14)15)20(16,17)18/h3-8H,1-2H3 |
| InChIKey | WKYPTYPPVNSYOW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |