3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride

C12H7Cl2FO3S — CID 61375597

IUPAC3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Oc2ccccc2F)c(Cl)c1
InChIInChI=1S/C12H7Cl2FO3S/c13-9-7-8(19(14,16)17)5-6-11(9)18-12-4-2-1-3-10(12)15/h1-7H
InChIKeyKGFKEULLQBUMFG-UHFFFAOYSA-N
MW321.16 g/mol
LogP4.20
Rot. Bonds3

About 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride

3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride (PubChem CID 61375597) has the molecular formula C12H7Cl2FO3S and a molecular weight of 321.16 g/mol. Its IUPAC name is 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride
PubChem CID61375597
Molecular FormulaC12H7Cl2FO3S
Molecular Weight321.16 g/mol
Exact Mass319.95
IUPAC Name3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Oc2ccccc2F)c(Cl)c1
InChIInChI=1S/C12H7Cl2FO3S/c13-9-7-8(19(14,16)17)5-6-11(9)18-12-4-2-1-3-10(12)15/h1-7H
InChIKeyKGFKEULLQBUMFG-UHFFFAOYSA-N
XLogP4.20
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.16
LogP ≤ 54.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride?
The IUPAC name of 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride (CID 61375597) is 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride.
What is the SMILES notation for 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride?
The canonical SMILES for 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(Oc2ccccc2F)c(Cl)c1.
What is the InChIKey of 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride?
The InChIKey is KGFKEULLQBUMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2FO3S/c13-9-7-8(19(14,16)17)5-6-11(9)18-12-4-2-1-3-10(12)15/h1-7H.
What are the key properties of 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride?
3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride has a molecular weight of 321.16 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2-fluorophenoxy)benzenesulfonyl chloride is sourced from PubChem (CID 61375597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).