C24H31ClO5S — CID 11476861
[4-[3-[3-chloro-4-(3,3-dimethyl-2-oxobutoxy)phenyl]pentan-3-yl]phenyl] methanesulfonate (PubChem CID 11476861) has the molecular formula C24H31ClO5S and a molecular weight of 467.03 g/mol. Its IUPAC name is [4-[3-[3-chloro-4-(3,3-dimethyl-2-oxobutoxy)phenyl]pentan-3-yl]phenyl] methanesulfonate.
| Compound Name | [4-[3-[3-chloro-4-(3,3-dimethyl-2-oxobutoxy)phenyl]pentan-3-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 11476861 |
| Molecular Formula | C24H31ClO5S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | [4-[3-[3-chloro-4-(3,3-dimethyl-2-oxobutoxy)phenyl]pentan-3-yl]phenyl] methanesulfonate |
| SMILES | CCC(CC)(c1ccc(OS(C)(=O)=O)cc1)c1ccc(OCC(=O)C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C24H31ClO5S/c1-7-24(8-2,17-9-12-19(13-10-17)30-31(6,27)28)18-11-14-21(20(25)15-18)29-16-22(26)23(3,4)5/h9-15H,7-8,16H2,1-6H3 |
| InChIKey | VHODUBGQYBTJIB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|