C27H36O7S — CID 11249140
2-[4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]sulfonylacetic acid (PubChem CID 11249140) has the molecular formula C27H36O7S and a molecular weight of 504.65 g/mol. Its IUPAC name is 2-[4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]sulfonylacetic acid.
| Compound Name | 2-[4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]sulfonylacetic acid |
|---|---|
| PubChem CID | 11249140 |
| Molecular Formula | C27H36O7S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-[4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]sulfonylacetic acid |
| SMILES | CCC(CC)(c1ccc(OCC(=O)C(C)(C)C)c(C)c1)c1ccc(OS(=O)(=O)CC(=O)O)c(C)c1 |
| InChI | InChI=1S/C27H36O7S/c1-8-27(9-2,20-10-12-22(18(3)14-20)33-16-24(28)26(5,6)7)21-11-13-23(19(4)15-21)34-35(31,32)17-25(29)30/h10-15H,8-9,16-17H2,1-7H3,(H,29,30) |
| InChIKey | IGDUNKFXUJGYLF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|