C25H34O3S — CID 143054655
3,3-dimethyl-1-[2-methyl-4-[3-(4-methylsulfanyloxyphenyl)pentan-3-yl]phenoxy]butan-2-one (PubChem CID 143054655) has the molecular formula C25H34O3S and a molecular weight of 414.61 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-methyl-4-[3-(4-methylsulfanyloxyphenyl)pentan-3-yl]phenoxy]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[2-methyl-4-[3-(4-methylsulfanyloxyphenyl)pentan-3-yl]phenoxy]butan-2-one |
|---|---|
| PubChem CID | 143054655 |
| Molecular Formula | C25H34O3S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 3,3-dimethyl-1-[2-methyl-4-[3-(4-methylsulfanyloxyphenyl)pentan-3-yl]phenoxy]butan-2-one |
| SMILES | CCC(CC)(c1ccc(OSC)cc1)c1ccc(OCC(=O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C25H34O3S/c1-8-25(9-2,19-10-13-21(14-11-19)28-29-7)20-12-15-22(18(3)16-20)27-17-23(26)24(4,5)6/h10-16H,8-9,17H2,1-7H3 |
| InChIKey | XFFQLWGMKFLBTB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|