C27H38O5S — CID 11408888
[4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl] ethanesulfonate (PubChem CID 11408888) has the molecular formula C27H38O5S and a molecular weight of 474.66 g/mol. Its IUPAC name is [4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl] ethanesulfonate.
| Compound Name | [4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl] ethanesulfonate |
|---|---|
| PubChem CID | 11408888 |
| Molecular Formula | C27H38O5S |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [4-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl] ethanesulfonate |
| SMILES | CCC(CC)(c1ccc(OCC(=O)C(C)(C)C)c(C)c1)c1ccc(OS(=O)(=O)CC)c(C)c1 |
| InChI | InChI=1S/C27H38O5S/c1-9-27(10-2,22-13-15-24(20(5)17-22)32-33(29,30)11-3)21-12-14-23(19(4)16-21)31-18-25(28)26(6,7)8/h12-17H,9-11,18H2,1-8H3 |
| InChIKey | NMVFIFIYRVEBJG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|