C27H38O3S — CID 143055020
5-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylbenzaldehyde;methanethiol (PubChem CID 143055020) has the molecular formula C27H38O3S and a molecular weight of 442.67 g/mol. Its IUPAC name is 5-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylbenzaldehyde;methanethiol.
| Compound Name | 5-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylbenzaldehyde;methanethiol |
|---|---|
| PubChem CID | 143055020 |
| Molecular Formula | C27H38O3S |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 5-[3-[4-(3,3-dimethyl-2-oxobutoxy)-3-methylphenyl]pentan-3-yl]-2-methylbenzaldehyde;methanethiol |
| SMILES | CCC(CC)(c1ccc(OCC(=O)C(C)(C)C)c(C)c1)c1ccc(C)c(C=O)c1.CS |
| InChI | InChI=1S/C26H34O3.CH4S/c1-8-26(9-2,22-11-10-18(3)20(15-22)16-27)21-12-13-23(19(4)14-21)29-17-24(28)25(5,6)7;1-2/h10-16H,8-9,17H2,1-7H3;2H,1H3 |
| InChIKey | SVBWPJHDLPEGBT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|