C18H18Cl2N2O2 — CID 88798454
1-[2-chloro-4-[(4-chlorophenyl)diazenyl]phenoxy]-3,3-dimethylbutan-2-one (PubChem CID 88798454) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-[2-chloro-4-[(4-chlorophenyl)diazenyl]phenoxy]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[2-chloro-4-[(4-chlorophenyl)diazenyl]phenoxy]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 88798454 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[2-chloro-4-[(4-chlorophenyl)diazenyl]phenoxy]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)COc1ccc(/N=N/c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-18(2,3)17(23)11-24-16-9-8-14(10-15(16)20)22-21-13-6-4-12(19)5-7-13/h4-10H,11H2,1-3H3/b22-21+ |
| InChIKey | XMJQJDFMUQTKGV-QURGRASLSA-N |
| XLogP | 6.40 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|