C14H17Cl2NO3 — CID 2195214
(3,3-dimethylbut-1-en-2-ylamino) 2-(2,4-dichlorophenoxy)acetate (PubChem CID 2195214) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is (3,3-dimethylbut-1-en-2-ylamino) 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | (3,3-dimethylbut-1-en-2-ylamino) 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 2195214 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (3,3-dimethylbut-1-en-2-ylamino) 2-(2,4-dichlorophenoxy)acetate |
| SMILES | C=C(NOC(=O)COc1ccc(Cl)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C14H17Cl2NO3/c1-9(14(2,3)4)17-20-13(18)8-19-12-6-5-10(15)7-11(12)16/h5-7,17H,1,8H2,2-4H3 |
| InChIKey | BQNNCSZYGOPSJG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|