C16H21Cl2N2O5+ — CID 166862491
[[2-(2,4-dichlorophenoxy)acetyl]oxyamino]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 166862491) has the molecular formula C16H21Cl2N2O5+ and a molecular weight of 392.26 g/mol. Its IUPAC name is [[2-(2,4-dichlorophenoxy)acetyl]oxyamino]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | [[2-(2,4-dichlorophenoxy)acetyl]oxyamino]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 166862491 |
| Molecular Formula | C16H21Cl2N2O5+ |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | [[2-(2,4-dichlorophenoxy)acetyl]oxyamino]-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)NOC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N2O5/c1-11(2)16(22)23-8-7-20(3,4)19-25-15(21)10-24-14-6-5-12(17)9-13(14)18/h5-6,9,19H,1,7-8,10H2,2-4H3/q+1 |
| InChIKey | AXWFGSOBOPCXKP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|