C13H15Cl2NO2 — CID 2195216
(3,3-dimethylbut-1-en-2-ylamino) 2,4-dichlorobenzoate (PubChem CID 2195216) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is (3,3-dimethylbut-1-en-2-ylamino) 2,4-dichlorobenzoate.
| Compound Name | (3,3-dimethylbut-1-en-2-ylamino) 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2195216 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (3,3-dimethylbut-1-en-2-ylamino) 2,4-dichlorobenzoate |
| SMILES | C=C(NOC(=O)c1ccc(Cl)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C13H15Cl2NO2/c1-8(13(2,3)4)16-18-12(17)10-6-5-9(14)7-11(10)15/h5-7,16H,1H2,2-4H3 |
| InChIKey | LKQPSRQCWBZVFC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|