C12H5Br2Cl2NO3S — CID 57112508
[(2,4-dichlorobenzoyl)amino] 4,5-dibromothiophene-2-carboxylate (PubChem CID 57112508) has the molecular formula C12H5Br2Cl2NO3S and a molecular weight of 473.96 g/mol. Its IUPAC name is [(2,4-dichlorobenzoyl)amino] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [(2,4-dichlorobenzoyl)amino] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 57112508 |
| Molecular Formula | C12H5Br2Cl2NO3S |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 470.77 |
| IUPAC Name | [(2,4-dichlorobenzoyl)amino] 4,5-dibromothiophene-2-carboxylate |
| SMILES | O=C(ONC(=O)c1ccc(Cl)cc1Cl)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H5Br2Cl2NO3S/c13-7-4-9(21-10(7)14)12(19)20-17-11(18)6-2-1-5(15)3-8(6)16/h1-4H,(H,17,18) |
| InChIKey | JHFHCOHFVRTELR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|