C11H4Br2Cl2OS — CID 80532703
(4,5-dibromothiophen-2-yl)-(2,5-dichlorophenyl)methanone (PubChem CID 80532703) has the molecular formula C11H4Br2Cl2OS and a molecular weight of 414.93 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(2,5-dichlorophenyl)methanone.
| Compound Name | (4,5-dibromothiophen-2-yl)-(2,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 80532703 |
| Molecular Formula | C11H4Br2Cl2OS |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 411.77 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(2,5-dichlorophenyl)methanone |
| SMILES | O=C(c1cc(Br)c(Br)s1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H4Br2Cl2OS/c12-7-4-9(17-11(7)13)10(16)6-3-5(14)1-2-8(6)15/h1-4H |
| InChIKey | YYQQKAGBTVYEDD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |