C13H6Br2ClNO2S — CID 80536252
6-chloro-5-(4,5-dibromothiophene-2-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 80536252) has the molecular formula C13H6Br2ClNO2S and a molecular weight of 435.52 g/mol. Its IUPAC name is 6-chloro-5-(4,5-dibromothiophene-2-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(4,5-dibromothiophene-2-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 80536252 |
| Molecular Formula | C13H6Br2ClNO2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 432.82 |
| IUPAC Name | 6-chloro-5-(4,5-dibromothiophene-2-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(=O)c3cc(Br)c(Br)s3)c(Cl)cc2N1 |
| InChI | InChI=1S/C13H6Br2ClNO2S/c14-7-3-10(20-13(7)15)12(19)6-1-5-2-11(18)17-9(5)4-8(6)16/h1,3-4H,2H2,(H,17,18) |
| InChIKey | ZIKXTMUPNMJBMS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |