C15H8Cl2INO2 — CID 103219673
6-chloro-5-(3-chloro-4-iodobenzoyl)-1,3-dihydroindol-2-one (PubChem CID 103219673) has the molecular formula C15H8Cl2INO2 and a molecular weight of 432.04 g/mol. Its IUPAC name is 6-chloro-5-(3-chloro-4-iodobenzoyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(3-chloro-4-iodobenzoyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 103219673 |
| Molecular Formula | C15H8Cl2INO2 |
| Molecular Weight | 432.04 g/mol |
| Exact Mass | 430.90 |
| IUPAC Name | 6-chloro-5-(3-chloro-4-iodobenzoyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(=O)c3ccc(I)c(Cl)c3)c(Cl)cc2N1 |
| InChI | InChI=1S/C15H8Cl2INO2/c16-10-6-13-8(5-14(20)19-13)3-9(10)15(21)7-1-2-12(18)11(17)4-7/h1-4,6H,5H2,(H,19,20) |
| InChIKey | SRDRHQWJTNLCEL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|