C14H9ClN2O2 — CID 43457490
6-chloro-5-(pyridine-3-carbonyl)-1,3-dihydroindol-2-one (PubChem CID 43457490) has the molecular formula C14H9ClN2O2 and a molecular weight of 272.69 g/mol. Its IUPAC name is 6-chloro-5-(pyridine-3-carbonyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(pyridine-3-carbonyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43457490 |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 6-chloro-5-(pyridine-3-carbonyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(=O)c3cccnc3)c(Cl)cc2N1 |
| InChI | InChI=1S/C14H9ClN2O2/c15-11-6-12-9(5-13(18)17-12)4-10(11)14(19)8-2-1-3-16-7-8/h1-4,6-7H,5H2,(H,17,18) |
| InChIKey | CLKVKMZKGJNULC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |