C15H10INO2 — CID 43338616
5-(2-iodobenzoyl)-1,3-dihydroindol-2-one (PubChem CID 43338616) has the molecular formula C15H10INO2 and a molecular weight of 363.15 g/mol. Its IUPAC name is 5-(2-iodobenzoyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-iodobenzoyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43338616 |
| Molecular Formula | C15H10INO2 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 5-(2-iodobenzoyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(=O)c3ccccc3I)ccc2N1 |
| InChI | InChI=1S/C15H10INO2/c16-12-4-2-1-3-11(12)15(19)9-5-6-13-10(7-9)8-14(18)17-13/h1-7H,8H2,(H,17,18) |
| InChIKey | VAKGTGHUUXPAEZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|