C10H6N2O2 — CID 116918958
2-oxo-1,3-dihydroindole-5-carbonyl cyanide (PubChem CID 116918958) has the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-oxo-1,3-dihydroindole-5-carbonyl cyanide.
| Compound Name | 2-oxo-1,3-dihydroindole-5-carbonyl cyanide |
|---|---|
| PubChem CID | 116918958 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 2-oxo-1,3-dihydroindole-5-carbonyl cyanide |
| SMILES | N#CC(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C10H6N2O2/c11-5-9(13)6-1-2-8-7(3-6)4-10(14)12-8/h1-3H,4H2,(H,12,14) |
| InChIKey | OOLVAFYLLCHBMO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|