C11H11N3O4 — CID 103901262
N-(2-amino-2-oxoethoxy)-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 103901262) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 103901262 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | NC(=O)CONC(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H11N3O4/c12-9(15)5-18-14-11(17)6-1-2-8-7(3-6)4-10(16)13-8/h1-3H,4-5H2,(H2,12,15)(H,13,16)(H,14,17) |
| InChIKey | PDOWDHWLHPFESB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|