C17H15NO2 — CID 43160594
5-(2,3-dimethylbenzoyl)-1,3-dihydroindol-2-one (PubChem CID 43160594) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 5-(2,3-dimethylbenzoyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2,3-dimethylbenzoyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43160594 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 5-(2,3-dimethylbenzoyl)-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc(C(=O)c2ccc3c(c2)CC(=O)N3)c1C |
| InChI | InChI=1S/C17H15NO2/c1-10-4-3-5-14(11(10)2)17(20)12-6-7-15-13(8-12)9-16(19)18-15/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | YAJPDOSYYZBKEJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |