C17H14N2O3 — CID 68698490
N-[3-(2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]acetamide (PubChem CID 68698490) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[3-(2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]acetamide.
| Compound Name | N-[3-(2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 68698490 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[3-(2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(=O)c2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C17H14N2O3/c1-10(20)18-14-4-2-3-11(8-14)17(22)12-5-6-15-13(7-12)9-16(21)19-15/h2-8H,9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | GHYPEIIPMQPPFY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |