C17H16N2O2 — CID 170984996
N-[3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]phenyl]acetamide (PubChem CID 170984996) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]phenyl]acetamide.
| Compound Name | N-[3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 170984996 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[3-[(2-oxo-1,3-dihydroindol-5-yl)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Cc2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C17H16N2O2/c1-11(20)18-15-4-2-3-12(9-15)7-13-5-6-16-14(8-13)10-17(21)19-16/h2-6,8-9H,7,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | WROWMPSBUMOQND-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |