C13H15NO2 — CID 116927752
5-(4-oxopentyl)-1,3-dihydroindol-2-one (PubChem CID 116927752) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-(4-oxopentyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(4-oxopentyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116927752 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 5-(4-oxopentyl)-1,3-dihydroindol-2-one |
| SMILES | CC(=O)CCCc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H15NO2/c1-9(15)3-2-4-10-5-6-12-11(7-10)8-13(16)14-12/h5-7H,2-4,8H2,1H3,(H,14,16) |
| InChIKey | DNPKUGVPLMMKSL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |