C17H23N3O2 — CID 119552860
N-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-N-pyrrolidin-3-ylbutanamide (PubChem CID 119552860) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-N-pyrrolidin-3-ylbutanamide.
| Compound Name | N-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-N-pyrrolidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119552860 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-N-pyrrolidin-3-ylbutanamide |
| SMILES | CN(C(=O)CCCc1ccc2c(c1)CC(=O)N2)C1CCNC1 |
| InChI | InChI=1S/C17H23N3O2/c1-20(14-7-8-18-11-14)17(22)4-2-3-12-5-6-15-13(9-12)10-16(21)19-15/h5-6,9,14,18H,2-4,7-8,10-11H2,1H3,(H,19,21) |
| InChIKey | HDBVMSVSPOHMMJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |