C23H26N2O2 — CID 154865923
5-[4-oxo-4-(2,3,3-trimethyl-2H-indol-1-yl)butyl]-1,3-dihydroindol-2-one (PubChem CID 154865923) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-[4-oxo-4-(2,3,3-trimethyl-2H-indol-1-yl)butyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[4-oxo-4-(2,3,3-trimethyl-2H-indol-1-yl)butyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 154865923 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 5-[4-oxo-4-(2,3,3-trimethyl-2H-indol-1-yl)butyl]-1,3-dihydroindol-2-one |
| SMILES | CC1N(C(=O)CCCc2ccc3c(c2)CC(=O)N3)c2ccccc2C1(C)C |
| InChI | InChI=1S/C23H26N2O2/c1-15-23(2,3)18-8-4-5-9-20(18)25(15)22(27)10-6-7-16-11-12-19-17(13-16)14-21(26)24-19/h4-5,8-9,11-13,15H,6-7,10,14H2,1-3H3,(H,24,26) |
| InChIKey | AFSROHHOCZJYCA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |