C17H23N3O2 — CID 124620564
5-[4-[(3R)-3-methylpiperazin-1-yl]-4-oxobutyl]-1,3-dihydroindol-2-one (PubChem CID 124620564) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-[4-[(3R)-3-methylpiperazin-1-yl]-4-oxobutyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[4-[(3R)-3-methylpiperazin-1-yl]-4-oxobutyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 124620564 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 5-[4-[(3R)-3-methylpiperazin-1-yl]-4-oxobutyl]-1,3-dihydroindol-2-one |
| SMILES | C[C@@H]1CN(C(=O)CCCc2ccc3c(c2)CC(=O)N3)CCN1 |
| InChI | InChI=1S/C17H23N3O2/c1-12-11-20(8-7-18-12)17(22)4-2-3-13-5-6-15-14(9-13)10-16(21)19-15/h5-6,9,12,18H,2-4,7-8,10-11H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | FJRXAGMNHWIJEX-GFCCVEGCSA-N |
| XLogP | 1.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |