C14H17N3O2 — CID 82301093
5-(2-oxo-2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one (PubChem CID 82301093) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-(2-oxo-2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-oxo-2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82301093 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 5-(2-oxo-2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CC(=O)N3CCNCC3)ccc2N1 |
| InChI | InChI=1S/C14H17N3O2/c18-13-9-11-7-10(1-2-12(11)16-13)8-14(19)17-5-3-15-4-6-17/h1-2,7,15H,3-6,8-9H2,(H,16,18) |
| InChIKey | OJJOQFCCCMJELU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |