C11H13N3O2 — CID 116844796
N-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)acetohydrazide (PubChem CID 116844796) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)acetohydrazide.
| Compound Name | N-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)acetohydrazide |
|---|---|
| PubChem CID | 116844796 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-methyl-2-(2-oxo-1,3-dihydroindol-5-yl)acetohydrazide |
| SMILES | CN(N)C(=O)Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H13N3O2/c1-14(12)11(16)5-7-2-3-9-8(4-7)6-10(15)13-9/h2-4H,5-6,12H2,1H3,(H,13,15) |
| InChIKey | FBGIFWDGTXETKP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|