C18H15NO4 — CID 164994429
5-[3-(1,3-benzodioxol-5-yl)-2-oxopropyl]-1,3-dihydroindol-2-one (PubChem CID 164994429) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 5-[3-(1,3-benzodioxol-5-yl)-2-oxopropyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[3-(1,3-benzodioxol-5-yl)-2-oxopropyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 164994429 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5-[3-(1,3-benzodioxol-5-yl)-2-oxopropyl]-1,3-dihydroindol-2-one |
| SMILES | O=C(Cc1ccc2c(c1)CC(=O)N2)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15NO4/c20-14(7-12-2-4-16-17(8-12)23-10-22-16)6-11-1-3-15-13(5-11)9-18(21)19-15/h1-5,8H,6-7,9-10H2,(H,19,21) |
| InChIKey | HIQHBQVGMKFVFD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |